C13H3Cl2F13O2 — CID 19913440
3-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)benzoyl chloride (PubChem CID 19913440) has the molecular formula C13H3Cl2F13O2 and a molecular weight of 509.05 g/mol. Its IUPAC name is 3-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)benzoyl chloride.
| Compound Name | 3-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)benzoyl chloride |
|---|---|
| PubChem CID | 19913440 |
| Molecular Formula | C13H3Cl2F13O2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 507.93 |
| IUPAC Name | 3-chloro-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexoxy)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H3Cl2F13O2/c14-5-3-4(7(15)29)1-2-6(5)30-13(27,28)11(22,23)9(18,19)8(16,17)10(20,21)12(24,25)26/h1-3H |
| InChIKey | OOSVQONCMABNOH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|