C12H8ClF3O4 — CID 123398420
2-[3-chloro-4-(trifluoromethoxy)benzoyl]cyclopropane-1-carboxylic acid (PubChem CID 123398420) has the molecular formula C12H8ClF3O4 and a molecular weight of 308.64 g/mol. Its IUPAC name is 2-[3-chloro-4-(trifluoromethoxy)benzoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[3-chloro-4-(trifluoromethoxy)benzoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 123398420 |
| Molecular Formula | C12H8ClF3O4 |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-[3-chloro-4-(trifluoromethoxy)benzoyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1CC1C(=O)c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H8ClF3O4/c13-8-3-5(1-2-9(8)20-12(14,15)16)10(17)6-4-7(6)11(18)19/h1-3,6-7H,4H2,(H,18,19) |
| InChIKey | XLPUHBGPCCLTCY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |