C13H7ClF3N3O4 — CID 167906608
4-[[3-chloro-4-(trifluoromethoxy)benzoyl]amino]pyrimidine-2-carboxylic acid (PubChem CID 167906608) has the molecular formula C13H7ClF3N3O4 and a molecular weight of 361.66 g/mol. Its IUPAC name is 4-[[3-chloro-4-(trifluoromethoxy)benzoyl]amino]pyrimidine-2-carboxylic acid.
| Compound Name | 4-[[3-chloro-4-(trifluoromethoxy)benzoyl]amino]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 167906608 |
| Molecular Formula | C13H7ClF3N3O4 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 4-[[3-chloro-4-(trifluoromethoxy)benzoyl]amino]pyrimidine-2-carboxylic acid |
| SMILES | O=C(Nc1ccnc(C(=O)O)n1)c1ccc(OC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C13H7ClF3N3O4/c14-7-5-6(1-2-8(7)24-13(15,16)17)11(21)20-9-3-4-18-10(19-9)12(22)23/h1-5H,(H,22,23)(H,18,19,20,21) |
| InChIKey | SFCRMYWTBVCQPQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |