C14H12BrClN2O2 — CID 1396763
N-(5-bromo-6-methyl-2-pyridinyl)-3-chloro-4-methoxybenzamide (PubChem CID 1396763) has the molecular formula C14H12BrClN2O2 and a molecular weight of 355.62 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-3-chloro-4-methoxybenzamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-chloro-4-methoxybenzamide |
|---|---|
| PubChem CID | 1396763 |
| Molecular Formula | C14H12BrClN2O2 |
| Molecular Weight | 355.62 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-chloro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Br)c(C)n2)cc1Cl |
| InChI | InChI=1S/C14H12BrClN2O2/c1-8-10(15)4-6-13(17-8)18-14(19)9-3-5-12(20-2)11(16)7-9/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | UQGUUAIIPDIINU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |