C13H9BrCl2N2O — CID 4509260
N-(5-bromo-6-methyl-2-pyridinyl)-3,4-dichlorobenzamide (PubChem CID 4509260) has the molecular formula C13H9BrCl2N2O and a molecular weight of 360.04 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-3,4-dichlorobenzamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 4509260 |
| Molecular Formula | C13H9BrCl2N2O |
| Molecular Weight | 360.04 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-3,4-dichlorobenzamide |
| SMILES | Cc1nc(NC(=O)c2ccc(Cl)c(Cl)c2)ccc1Br |
| InChI | InChI=1S/C13H9BrCl2N2O/c1-7-9(14)3-5-12(17-7)18-13(19)8-2-4-10(15)11(16)6-8/h2-6H,1H3,(H,17,18,19) |
| InChIKey | KCSBZXSFSOSCNH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.04 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |