C14H13BrN2O2 — CID 79048356
N-(5-bromo-6-methyl-2-pyridinyl)-3-hydroxy-4-methylbenzamide (PubChem CID 79048356) has the molecular formula C14H13BrN2O2 and a molecular weight of 321.17 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-3-hydroxy-4-methylbenzamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 79048356 |
| Molecular Formula | C14H13BrN2O2 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-3-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Br)c(C)n2)cc1O |
| InChI | InChI=1S/C14H13BrN2O2/c1-8-3-4-10(7-12(8)18)14(19)17-13-6-5-11(15)9(2)16-13/h3-7,18H,1-2H3,(H,16,17,19) |
| InChIKey | RYFRPXKFSMCNCJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |