C16H17BrN2O — CID 79048667
N-(5-bromo-6-methyl-2-pyridinyl)-2,4,6-trimethylbenzamide (PubChem CID 79048667) has the molecular formula C16H17BrN2O and a molecular weight of 333.23 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-2,4,6-trimethylbenzamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 79048667 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)Nc2ccc(Br)c(C)n2)c(C)c1 |
| InChI | InChI=1S/C16H17BrN2O/c1-9-7-10(2)15(11(3)8-9)16(20)19-14-6-5-13(17)12(4)18-14/h5-8H,1-4H3,(H,18,19,20) |
| InChIKey | WFXRQQFLDOYREP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |