C13H11BrN2O3 — CID 114343707
N-(5-bromo-6-methyl-2-pyridinyl)-2,3-dihydroxybenzamide (PubChem CID 114343707) has the molecular formula C13H11BrN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is N-(5-bromo-6-methyl-2-pyridinyl)-2,3-dihydroxybenzamide.
| Compound Name | N-(5-bromo-6-methyl-2-pyridinyl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114343707 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | N-(5-bromo-6-methyl-2-pyridinyl)-2,3-dihydroxybenzamide |
| SMILES | Cc1nc(NC(=O)c2cccc(O)c2O)ccc1Br |
| InChI | InChI=1S/C13H11BrN2O3/c1-7-9(14)5-6-11(15-7)16-13(19)8-3-2-4-10(17)12(8)18/h2-6,17-18H,1H3,(H,15,16,19) |
| InChIKey | DCKVUBBHUBOOBQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|