C24H18N6O9 — CID 164848329
N-[4,6-bis[(2,3-dihydroxybenzoyl)amino]-1,3,5-triazin-2-yl]-2,3-dihydroxybenzamide (PubChem CID 164848329) has the molecular formula C24H18N6O9 and a molecular weight of 534.44 g/mol. Its IUPAC name is N-[4,6-bis[(2,3-dihydroxybenzoyl)amino]-1,3,5-triazin-2-yl]-2,3-dihydroxybenzamide.
| Compound Name | N-[4,6-bis[(2,3-dihydroxybenzoyl)amino]-1,3,5-triazin-2-yl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 164848329 |
| Molecular Formula | C24H18N6O9 |
| Molecular Weight | 534.44 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | N-[4,6-bis[(2,3-dihydroxybenzoyl)amino]-1,3,5-triazin-2-yl]-2,3-dihydroxybenzamide |
| SMILES | O=C(Nc1nc(NC(=O)c2cccc(O)c2O)nc(NC(=O)c2cccc(O)c2O)n1)c1cccc(O)c1O |
| InChI | InChI=1S/C24H18N6O9/c31-13-7-1-4-10(16(13)34)19(37)25-22-28-23(26-20(38)11-5-2-8-14(32)17(11)35)30-24(29-22)27-21(39)12-6-3-9-15(33)18(12)36/h1-9,31-36H,(H3,25,26,27,28,29,30,37,38,39) |
| InChIKey | SSYSCEMLVBWUET-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 247.35 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|