C12H13N3O3 — CID 114251339
N-(1-ethylpyrazol-3-yl)-2,3-dihydroxybenzamide (PubChem CID 114251339) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-(1-ethylpyrazol-3-yl)-2,3-dihydroxybenzamide.
| Compound Name | N-(1-ethylpyrazol-3-yl)-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114251339 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(1-ethylpyrazol-3-yl)-2,3-dihydroxybenzamide |
| SMILES | CCn1ccc(NC(=O)c2cccc(O)c2O)n1 |
| InChI | InChI=1S/C12H13N3O3/c1-2-15-7-6-10(14-15)13-12(18)8-4-3-5-9(16)11(8)17/h3-7,16-17H,2H2,1H3,(H,13,14,18) |
| InChIKey | GNNOXHLOUCAKKA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|