C12H10ClF2N3O — CID 35286238
2-chloro-N-(1-ethylpyrazol-3-yl)-4,5-difluorobenzamide (PubChem CID 35286238) has the molecular formula C12H10ClF2N3O and a molecular weight of 285.68 g/mol. Its IUPAC name is 2-chloro-N-(1-ethylpyrazol-3-yl)-4,5-difluorobenzamide.
| Compound Name | 2-chloro-N-(1-ethylpyrazol-3-yl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 35286238 |
| Molecular Formula | C12H10ClF2N3O |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-chloro-N-(1-ethylpyrazol-3-yl)-4,5-difluorobenzamide |
| SMILES | CCn1ccc(NC(=O)c2cc(F)c(F)cc2Cl)n1 |
| InChI | InChI=1S/C12H10ClF2N3O/c1-2-18-4-3-11(17-18)16-12(19)7-5-9(14)10(15)6-8(7)13/h3-6H,2H2,1H3,(H,16,17,19) |
| InChIKey | KAPLSMWMIRGLIC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|