C14H14N2O3 — CID 114343071
N-[4-(aminomethyl)phenyl]-2,3-dihydroxybenzamide (PubChem CID 114343071) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[4-(aminomethyl)phenyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 114343071 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-2,3-dihydroxybenzamide |
| SMILES | NCc1ccc(NC(=O)c2cccc(O)c2O)cc1 |
| InChI | InChI=1S/C14H14N2O3/c15-8-9-4-6-10(7-5-9)16-14(19)11-2-1-3-12(17)13(11)18/h1-7,17-18H,8,15H2,(H,16,19) |
| InChIKey | CNZDQHYIGRXKSF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|