C19H19ClN2O2 — CID 164615663
N-[4-(aminomethyl)phenyl]-1-hydroxy-7-methylnaphthalene-2-carboxamide;hydrochloride (PubChem CID 164615663) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is N-[4-(aminomethyl)phenyl]-1-hydroxy-7-methylnaphthalene-2-carboxamide;hydrochloride.
| Compound Name | N-[4-(aminomethyl)phenyl]-1-hydroxy-7-methylnaphthalene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 164615663 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | N-[4-(aminomethyl)phenyl]-1-hydroxy-7-methylnaphthalene-2-carboxamide;hydrochloride |
| SMILES | Cc1ccc2ccc(C(=O)Nc3ccc(CN)cc3)c(O)c2c1.Cl |
| InChI | InChI=1S/C19H18N2O2.ClH/c1-12-2-5-14-6-9-16(18(22)17(14)10-12)19(23)21-15-7-3-13(11-20)4-8-15;/h2-10,22H,11,20H2,1H3,(H,21,23);1H |
| InChIKey | NZFYWWDASAKNPV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |