C18H15NO4S — CID 59136445
1-hydroxy-N-(4-methylsulfonylphenyl)naphthalene-2-carboxamide (PubChem CID 59136445) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1-hydroxy-N-(4-methylsulfonylphenyl)naphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-N-(4-methylsulfonylphenyl)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 59136445 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 1-hydroxy-N-(4-methylsulfonylphenyl)naphthalene-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2ccc3ccccc3c2O)cc1 |
| InChI | InChI=1S/C18H15NO4S/c1-24(22,23)14-9-7-13(8-10-14)19-18(21)16-11-6-12-4-2-3-5-15(12)17(16)20/h2-11,20H,1H3,(H,19,21) |
| InChIKey | VBDYOPMZKQMAPM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |