C36H26N2NaO10S2+ — CID 54611291
sodium 5-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-[(Z)-2-[4-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 54611291) has the molecular formula C36H26N2NaO10S2+ and a molecular weight of 733.73 g/mol. Its IUPAC name is sodium 5-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-[(Z)-2-[4-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-[(Z)-2-[4-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54611291 |
| Molecular Formula | C36H26N2NaO10S2+ |
| Molecular Weight | 733.73 g/mol |
| Exact Mass | 733.09 |
| IUPAC Name | sodium 5-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-[(Z)-2-[4-[(1-hydroxynaphthalene-2-carbonyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | O=C(Nc1ccc(/C=C\c2ccc(NC(=O)c3ccc4ccccc4c3O)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1)c1ccc2ccccc2c1O.[Na+] |
| InChI | InChI=1S/C36H26N2O10S2.Na/c39-33-27-7-3-1-5-21(27)13-17-29(33)35(41)37-25-15-11-23(31(19-25)49(43,44)45)9-10-24-12-16-26(20-32(24)50(46,47)48)38-36(42)30-18-14-22-6-2-4-8-28(22)34(30)40;/h1-20,39-40H,(H,37,41)(H,38,42)(H,43,44,45)(H,46,47,48);/q;+1/b10-9-; |
| InChIKey | KFCZCTJGRANJCU-KVVVOXFISA-N |
| XLogP | 3.58 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.73 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|