C20H22N2O10S2 — CID 89315900
5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 89315900) has the molecular formula C20H22N2O10S2 and a molecular weight of 514.53 g/mol. Its IUPAC name is 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 89315900 |
| Molecular Formula | C20H22N2O10S2 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-[(2-methoxyacetyl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | COCC(=O)Nc1ccc(/C=C/c2ccc(NC(=O)COC)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H22N2O10S2/c1-31-11-19(23)21-15-7-5-13(17(9-15)33(25,26)27)3-4-14-6-8-16(22-20(24)12-32-2)10-18(14)34(28,29)30/h3-10H,11-12H2,1-2H3,(H,21,23)(H,22,24)(H,25,26,27)(H,28,29,30)/b4-3+ |
| InChIKey | OUBYWQOQPZGHTL-ONEGZZNKSA-N |
| XLogP | 1.52 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|