C21H24N2NaO9S2+ — CID 71487009
sodium 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(2-methylpropanoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 71487009) has the molecular formula C21H24N2NaO9S2+ and a molecular weight of 535.55 g/mol. Its IUPAC name is sodium 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(2-methylpropanoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | sodium 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(2-methylpropanoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 71487009 |
| Molecular Formula | C21H24N2NaO9S2+ |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.08 |
| IUPAC Name | sodium 5-[(2-methoxyacetyl)amino]-2-[(E)-2-[4-(2-methylpropanoylamino)-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | COCC(=O)Nc1ccc(/C=C/c2ccc(NC(=O)C(C)C)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1.[Na+] |
| InChI | InChI=1S/C21H24N2O9S2.Na/c1-13(2)21(25)23-17-9-7-15(19(11-17)34(29,30)31)5-4-14-6-8-16(22-20(24)12-32-3)10-18(14)33(26,27)28;/h4-11,13H,12H2,1-3H3,(H,22,24)(H,23,25)(H,26,27,28)(H,29,30,31);/q;+1/b5-4+; |
| InChIKey | FPKFPRUZAAQDEH-FXRZFVDSSA-N |
| XLogP | -0.47 |
| TPSA | 176.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|