C21H23N3Na2O8S2 — CID 140612069
disodium;2-[(E)-2-[4-(ethylcarbamoylamino)-2-sulfonatophenyl]ethenyl]-5-(2-methylpropanoylamino)benzenesulfonate (PubChem CID 140612069) has the molecular formula C21H23N3Na2O8S2 and a molecular weight of 555.54 g/mol. Its IUPAC name is disodium;2-[(E)-2-[4-(ethylcarbamoylamino)-2-sulfonatophenyl]ethenyl]-5-(2-methylpropanoylamino)benzenesulfonate.
| Compound Name | disodium;2-[(E)-2-[4-(ethylcarbamoylamino)-2-sulfonatophenyl]ethenyl]-5-(2-methylpropanoylamino)benzenesulfonate |
|---|---|
| PubChem CID | 140612069 |
| Molecular Formula | C21H23N3Na2O8S2 |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 555.07 |
| IUPAC Name | disodium;2-[(E)-2-[4-(ethylcarbamoylamino)-2-sulfonatophenyl]ethenyl]-5-(2-methylpropanoylamino)benzenesulfonate |
| SMILES | CCNC(=O)Nc1ccc(/C=C/c2ccc(NC(=O)C(C)C)cc2S(=O)(=O)[O-])c(S(=O)(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C21H25N3O8S2.2Na/c1-4-22-21(26)24-17-10-8-15(19(12-17)34(30,31)32)6-5-14-7-9-16(23-20(25)13(2)3)11-18(14)33(27,28)29;;/h5-13H,4H2,1-3H3,(H,23,25)(H2,22,24,26)(H,27,28,29)(H,30,31,32);;/q;2*+1/p-2/b6-5+;; |
| InChIKey | QOMTYHPMAPTOKY-TXOOBNKBSA-L |
| XLogP | -3.59 |
| TPSA | 184.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|