C14H10Na2O8S2 — CID 139911100
disodium;5-hydroxy-2-[2-(4-hydroxy-2-sulfonatophenyl)ethenyl]benzenesulfonate (PubChem CID 139911100) has the molecular formula C14H10Na2O8S2 and a molecular weight of 416.34 g/mol. Its IUPAC name is disodium;5-hydroxy-2-[2-(4-hydroxy-2-sulfonatophenyl)ethenyl]benzenesulfonate.
| Compound Name | disodium;5-hydroxy-2-[2-(4-hydroxy-2-sulfonatophenyl)ethenyl]benzenesulfonate |
|---|---|
| PubChem CID | 139911100 |
| Molecular Formula | C14H10Na2O8S2 |
| Molecular Weight | 416.34 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | disodium;5-hydroxy-2-[2-(4-hydroxy-2-sulfonatophenyl)ethenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1cc(O)ccc1C=Cc1ccc(O)cc1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H12O8S2.2Na/c15-11-5-3-9(13(7-11)23(17,18)19)1-2-10-4-6-12(16)8-14(10)24(20,21)22;;/h1-8,15-16H,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 |
| InChIKey | JBFVTFJDHMFSRH-UHFFFAOYSA-L |
| XLogP | -4.92 |
| TPSA | 154.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.34 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|