C6H9NO5S — CID 6453214
azanium 2,4-dihydroxybenzenesulfonate (PubChem CID 6453214) has the molecular formula C6H9NO5S and a molecular weight of 207.21 g/mol. Its IUPAC name is azanium 2,4-dihydroxybenzenesulfonate.
| Compound Name | azanium 2,4-dihydroxybenzenesulfonate |
|---|---|
| PubChem CID | 6453214 |
| Molecular Formula | C6H9NO5S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | azanium 2,4-dihydroxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(O)cc1O.[NH4+] |
| InChI | InChI=1S/C6H6O5S.H3N/c7-4-1-2-6(5(8)3-4)12(9,10)11;/h1-3,7-8H,(H,9,10,11);1H3 |
| InChIKey | JOILQYURMOSQTJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 134.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|