C12H11NO4S — CID 23274890
4-(4-aminophenyl)sulfonylbenzene-1,3-diol (PubChem CID 23274890) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonylbenzene-1,3-diol.
| Compound Name | 4-(4-aminophenyl)sulfonylbenzene-1,3-diol |
|---|---|
| PubChem CID | 23274890 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylbenzene-1,3-diol |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C12H11NO4S/c13-8-1-4-10(5-2-8)18(16,17)12-6-3-9(14)7-11(12)15/h1-7,14-15H,13H2 |
| InChIKey | NQQLJFOGMTTYCZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|