About 4-(4-aminophenyl)sulfonylaniline;dihydroiodide
4-(4-aminophenyl)sulfonylaniline;dihydroiodide (PubChem CID 24833766) has the molecular formula C12H14I2N2O2S
and a molecular weight of 504.13 g/mol. Its IUPAC name is 4-(4-aminophenyl)sulfonylaniline;dihydroiodide.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)sulfonylaniline;dihydroiodide |
| PubChem CID | 24833766 |
| Molecular Formula | C12H14I2N2O2S |
| Molecular Weight | 504.13 g/mol |
| Exact Mass | 503.89 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylaniline;dihydroiodide |
| SMILES | I.I.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C12H12N2O2S.2HI/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;;/h1-8H,13-14H2;2*1H |
| InChIKey | WGBCIZQUQYKSKB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 504.13 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)sulfonylaniline;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)sulfonylaniline;dihydroiodide?
The IUPAC name of 4-(4-aminophenyl)sulfonylaniline;dihydroiodide (CID 24833766) is 4-(4-aminophenyl)sulfonylaniline;dihydroiodide.
What is the SMILES notation for 4-(4-aminophenyl)sulfonylaniline;dihydroiodide?
The canonical SMILES for 4-(4-aminophenyl)sulfonylaniline;dihydroiodide is I.I.Nc1ccc(S(=O)(=O)c2ccc(N)cc2)cc1.
What is the InChIKey of 4-(4-aminophenyl)sulfonylaniline;dihydroiodide?
The InChIKey is WGBCIZQUQYKSKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S.2HI/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;;/h1-8H,13-14H2;2*1H.
What are the key properties of 4-(4-aminophenyl)sulfonylaniline;dihydroiodide?
4-(4-aminophenyl)sulfonylaniline;dihydroiodide has a molecular weight of 504.13 g/mol, XLogP of 2.92, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)sulfonylaniline;dihydroiodide is sourced from PubChem (CID 24833766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).