C19H17NO3S — CID 6611791
4-[4-(4-methylphenyl)sulfonylphenoxy]aniline (PubChem CID 6611791) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)sulfonylphenoxy]aniline.
| Compound Name | 4-[4-(4-methylphenyl)sulfonylphenoxy]aniline |
|---|---|
| PubChem CID | 6611791 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 4-[4-(4-methylphenyl)sulfonylphenoxy]aniline |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Oc3ccc(N)cc3)cc2)cc1 |
| InChI | InChI=1S/C19H17NO3S/c1-14-2-10-18(11-3-14)24(21,22)19-12-8-17(9-13-19)23-16-6-4-15(20)5-7-16/h2-13H,20H2,1H3 |
| InChIKey | FYQDMLBWORCYQY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|