C36H30N2O4S — CID 160996826
4-[4-[4-(4-aminophenoxy)phenyl]sulfonylphenoxy]aniline;1,1'-biphenyl (PubChem CID 160996826) has the molecular formula C36H30N2O4S and a molecular weight of 586.71 g/mol. Its IUPAC name is 4-[4-[4-(4-aminophenoxy)phenyl]sulfonylphenoxy]aniline;1,1'-biphenyl.
| Compound Name | 4-[4-[4-(4-aminophenoxy)phenyl]sulfonylphenoxy]aniline;1,1'-biphenyl |
|---|---|
| PubChem CID | 160996826 |
| Molecular Formula | C36H30N2O4S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 4-[4-[4-(4-aminophenoxy)phenyl]sulfonylphenoxy]aniline;1,1'-biphenyl |
| SMILES | Nc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(N)cc4)cc3)cc2)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20N2O4S.C12H10/c25-17-1-5-19(6-2-17)29-21-9-13-23(14-10-21)31(27,28)24-15-11-22(12-16-24)30-20-7-3-18(26)4-8-20;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-16H,25-26H2;1-10H |
| InChIKey | TVIZUNAXFXCOII-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|