C25H20O5S — CID 90321363
4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenoxy]phenol (PubChem CID 90321363) has the molecular formula C25H20O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is 4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenoxy]phenol.
| Compound Name | 4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenoxy]phenol |
|---|---|
| PubChem CID | 90321363 |
| Molecular Formula | C25H20O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenoxy]phenol |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(Oc3ccc(Oc4ccc(O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H20O5S/c1-18-2-14-24(15-3-18)31(27,28)25-16-12-23(13-17-25)30-22-10-8-21(9-11-22)29-20-6-4-19(26)5-7-20/h2-17,26H,1H3 |
| InChIKey | UCWWZPLFNUPXBM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |