C39H34O11S3 — CID 90873606
methanesulfonic acid;1-[4-[4-[4-[4-(4-methoxyphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonyl-4-methylbenzene (PubChem CID 90873606) has the molecular formula C39H34O11S3 and a molecular weight of 774.89 g/mol. Its IUPAC name is methanesulfonic acid;1-[4-[4-[4-[4-(4-methoxyphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonyl-4-methylbenzene.
| Compound Name | methanesulfonic acid;1-[4-[4-[4-[4-(4-methoxyphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 90873606 |
| Molecular Formula | C39H34O11S3 |
| Molecular Weight | 774.89 g/mol |
| Exact Mass | 774.13 |
| IUPAC Name | methanesulfonic acid;1-[4-[4-[4-[4-(4-methoxyphenoxy)phenyl]sulfonylphenoxy]phenoxy]phenyl]sulfonyl-4-methylbenzene |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)c3ccc(Oc4ccc(Oc5ccc(S(=O)(=O)c6ccc(C)cc6)cc5)cc4)cc3)cc2)cc1.CS(=O)(=O)O |
| InChI | InChI=1S/C38H30O8S2.CH4O3S/c1-27-3-19-35(20-4-27)47(39,40)36-21-13-33(14-22-36)45-30-9-11-31(12-10-30)46-34-17-25-38(26-18-34)48(41,42)37-23-15-32(16-24-37)44-29-7-5-28(43-2)6-8-29;1-5(2,3)4/h3-26H,1-2H3;1H3,(H,2,3,4) |
| InChIKey | NWIHGKBGYCJUCS-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.89 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|