C20H18O6S2 — CID 71186281
1-methoxy-4-[4-(4-methoxyphenyl)sulfonylphenyl]sulfonylbenzene (PubChem CID 71186281) has the molecular formula C20H18O6S2 and a molecular weight of 418.49 g/mol. Its IUPAC name is 1-methoxy-4-[4-(4-methoxyphenyl)sulfonylphenyl]sulfonylbenzene.
| Compound Name | 1-methoxy-4-[4-(4-methoxyphenyl)sulfonylphenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 71186281 |
| Molecular Formula | C20H18O6S2 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 1-methoxy-4-[4-(4-methoxyphenyl)sulfonylphenyl]sulfonylbenzene |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H18O6S2/c1-25-15-3-7-17(8-4-15)27(21,22)19-11-13-20(14-12-19)28(23,24)18-9-5-16(26-2)6-10-18/h3-14H,1-2H3 |
| InChIKey | SFDYSUILEJNVJT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |