C27H24O9S3 — CID 91532312
1,2,3-tris[(4-methoxyphenyl)sulfonyl]benzene (PubChem CID 91532312) has the molecular formula C27H24O9S3 and a molecular weight of 588.68 g/mol. Its IUPAC name is 1,2,3-tris[(4-methoxyphenyl)sulfonyl]benzene.
| Compound Name | 1,2,3-tris[(4-methoxyphenyl)sulfonyl]benzene |
|---|---|
| PubChem CID | 91532312 |
| Molecular Formula | C27H24O9S3 |
| Molecular Weight | 588.68 g/mol |
| Exact Mass | 588.06 |
| IUPAC Name | 1,2,3-tris[(4-methoxyphenyl)sulfonyl]benzene |
| SMILES | COc1ccc(S(=O)(=O)c2cccc(S(=O)(=O)c3ccc(OC)cc3)c2S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H24O9S3/c1-34-19-7-13-22(14-8-19)37(28,29)25-5-4-6-26(38(30,31)23-15-9-20(35-2)10-16-23)27(25)39(32,33)24-17-11-21(36-3)12-18-24/h4-18H,1-3H3 |
| InChIKey | QEYQGSKFOWLRPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.68 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |