About 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine
4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine (PubChem CID 54189244) has the molecular formula C14H15NO3S
and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine |
| PubChem CID | 54189244 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine |
| SMILES | COc1ccc(S(=O)(=O)c2ccnc(C)c2C)cc1 |
| InChI | InChI=1S/C14H15NO3S/c1-10-11(2)15-9-8-14(10)19(16,17)13-6-4-12(18-3)5-7-13/h4-9H,1-3H3 |
| InChIKey | PHIHBDIYLUOVII-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine?
The IUPAC name of 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine (CID 54189244) is 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine.
What is the SMILES notation for 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine?
The canonical SMILES for 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine is COc1ccc(S(=O)(=O)c2ccnc(C)c2C)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine?
The InChIKey is PHIHBDIYLUOVII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S/c1-10-11(2)15-9-8-14(10)19(16,17)13-6-4-12(18-3)5-7-13/h4-9H,1-3H3.
What are the key properties of 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine?
4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine has a molecular weight of 277.35 g/mol, XLogP of 2.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine is sourced from PubChem (CID 54189244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).