C14H15NO3S — CID 54189244
4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine (PubChem CID 54189244) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine.
| Compound Name | 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine |
|---|---|
| PubChem CID | 54189244 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 4-(4-methoxyphenyl)sulfonyl-2,3-dimethylpyridine |
| SMILES | COc1ccc(S(=O)(=O)c2ccnc(C)c2C)cc1 |
| InChI | InChI=1S/C14H15NO3S/c1-10-11(2)15-9-8-14(10)19(16,17)13-6-4-12(18-3)5-7-13/h4-9H,1-3H3 |
| InChIKey | PHIHBDIYLUOVII-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |