C22H18N2O6S2 — CID 71186031
5,8-bis[(4-methoxyphenyl)sulfonyl]quinoxaline (PubChem CID 71186031) has the molecular formula C22H18N2O6S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 5,8-bis[(4-methoxyphenyl)sulfonyl]quinoxaline.
| Compound Name | 5,8-bis[(4-methoxyphenyl)sulfonyl]quinoxaline |
|---|---|
| PubChem CID | 71186031 |
| Molecular Formula | C22H18N2O6S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 5,8-bis[(4-methoxyphenyl)sulfonyl]quinoxaline |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)c3ccc(OC)cc3)c3nccnc23)cc1 |
| InChI | InChI=1S/C22H18N2O6S2/c1-29-15-3-7-17(8-4-15)31(25,26)19-11-12-20(22-21(19)23-13-14-24-22)32(27,28)18-9-5-16(30-2)6-10-18/h3-14H,1-2H3 |
| InChIKey | ABGPZJZNPSCQBV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |