C15H16O5S — CID 132609518
1,4-dimethoxy-2-(4-methoxyphenyl)sulfonylbenzene (PubChem CID 132609518) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(4-methoxyphenyl)sulfonylbenzene.
| Compound Name | 1,4-dimethoxy-2-(4-methoxyphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 132609518 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1,4-dimethoxy-2-(4-methoxyphenyl)sulfonylbenzene |
| SMILES | COc1ccc(S(=O)(=O)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C15H16O5S/c1-18-11-4-7-13(8-5-11)21(16,17)15-10-12(19-2)6-9-14(15)20-3/h4-10H,1-3H3 |
| InChIKey | BPZRKTLTZGBREQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |