C15H16O3S — CID 145226676
1-methoxy-4-methyl-2-(4-methylphenyl)sulfonylbenzene (PubChem CID 145226676) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-methoxy-4-methyl-2-(4-methylphenyl)sulfonylbenzene.
| Compound Name | 1-methoxy-4-methyl-2-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 145226676 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-methoxy-4-methyl-2-(4-methylphenyl)sulfonylbenzene |
| SMILES | COc1ccc(C)cc1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H16O3S/c1-11-4-7-13(8-5-11)19(16,17)15-10-12(2)6-9-14(15)18-3/h4-10H,1-3H3 |
| InChIKey | AFCZJHOIMGWKGP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |