C16H19O4PS — CID 59266905
2-dimethylphosphoryl-1-methoxy-4-(4-methylphenyl)sulfonylbenzene (PubChem CID 59266905) has the molecular formula C16H19O4PS and a molecular weight of 338.37 g/mol. Its IUPAC name is 2-dimethylphosphoryl-1-methoxy-4-(4-methylphenyl)sulfonylbenzene.
| Compound Name | 2-dimethylphosphoryl-1-methoxy-4-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 59266905 |
| Molecular Formula | C16H19O4PS |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-dimethylphosphoryl-1-methoxy-4-(4-methylphenyl)sulfonylbenzene |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1P(C)(C)=O |
| InChI | InChI=1S/C16H19O4PS/c1-12-5-7-13(8-6-12)22(18,19)14-9-10-15(20-2)16(11-14)21(3,4)17/h5-11H,1-4H3 |
| InChIKey | ZFYXSXSINGCXGC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|