C21H18O6S — CID 130396430
2-methoxy-5-[4-(4-methylphenyl)sulfonylphenoxy]benzoic acid (PubChem CID 130396430) has the molecular formula C21H18O6S and a molecular weight of 398.44 g/mol. Its IUPAC name is 2-methoxy-5-[4-(4-methylphenyl)sulfonylphenoxy]benzoic acid.
| Compound Name | 2-methoxy-5-[4-(4-methylphenyl)sulfonylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 130396430 |
| Molecular Formula | C21H18O6S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-methoxy-5-[4-(4-methylphenyl)sulfonylphenoxy]benzoic acid |
| SMILES | COc1ccc(Oc2ccc(S(=O)(=O)c3ccc(C)cc3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C21H18O6S/c1-14-3-8-17(9-4-14)28(24,25)18-10-5-15(6-11-18)27-16-7-12-20(26-2)19(13-16)21(22)23/h3-13H,1-2H3,(H,22,23) |
| InChIKey | YWRFPZPPAFPSMH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |