C20H16O6S — CID 19106016
2-hydroxy-5-[3-(4-methylphenyl)sulfonylphenoxy]benzoic acid (PubChem CID 19106016) has the molecular formula C20H16O6S and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-hydroxy-5-[3-(4-methylphenyl)sulfonylphenoxy]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-(4-methylphenyl)sulfonylphenoxy]benzoic acid |
|---|---|
| PubChem CID | 19106016 |
| Molecular Formula | C20H16O6S |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-hydroxy-5-[3-(4-methylphenyl)sulfonylphenoxy]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)c2cccc(Oc3ccc(O)c(C(=O)O)c3)c2)cc1 |
| InChI | InChI=1S/C20H16O6S/c1-13-5-8-16(9-6-13)27(24,25)17-4-2-3-14(11-17)26-15-7-10-19(21)18(12-15)20(22)23/h2-12,21H,1H3,(H,22,23) |
| InChIKey | QAXKEOSVNLQYDH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |