C17H18O6S — CID 57033435
2-hydroxy-5-[3-(3-methylphenyl)sulfonylpropoxy]benzoic acid (PubChem CID 57033435) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is 2-hydroxy-5-[3-(3-methylphenyl)sulfonylpropoxy]benzoic acid.
| Compound Name | 2-hydroxy-5-[3-(3-methylphenyl)sulfonylpropoxy]benzoic acid |
|---|---|
| PubChem CID | 57033435 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2-hydroxy-5-[3-(3-methylphenyl)sulfonylpropoxy]benzoic acid |
| SMILES | Cc1cccc(S(=O)(=O)CCCOc2ccc(O)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C17H18O6S/c1-12-4-2-5-14(10-12)24(21,22)9-3-8-23-13-6-7-16(18)15(11-13)17(19)20/h2,4-7,10-11,18H,3,8-9H2,1H3,(H,19,20) |
| InChIKey | BZHAFNPKLPYJDV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|