C16H15ClO6S — CID 54039656
5-[3-(4-chlorophenyl)sulfonylpropoxy]-2-hydroxybenzoic acid (PubChem CID 54039656) has the molecular formula C16H15ClO6S and a molecular weight of 370.81 g/mol. Its IUPAC name is 5-[3-(4-chlorophenyl)sulfonylpropoxy]-2-hydroxybenzoic acid.
| Compound Name | 5-[3-(4-chlorophenyl)sulfonylpropoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54039656 |
| Molecular Formula | C16H15ClO6S |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5-[3-(4-chlorophenyl)sulfonylpropoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(OCCCS(=O)(=O)c2ccc(Cl)cc2)ccc1O |
| InChI | InChI=1S/C16H15ClO6S/c17-11-2-5-13(6-3-11)24(21,22)9-1-8-23-12-4-7-15(18)14(10-12)16(19)20/h2-7,10,18H,1,8-9H2,(H,19,20) |
| InChIKey | LLLBEBAHRJSPMV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|