C15H14O6S — CID 19106295
5-[2-(benzenesulfonyl)ethoxy]-2-hydroxybenzoic acid (PubChem CID 19106295) has the molecular formula C15H14O6S and a molecular weight of 322.34 g/mol. Its IUPAC name is 5-[2-(benzenesulfonyl)ethoxy]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-(benzenesulfonyl)ethoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19106295 |
| Molecular Formula | C15H14O6S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-[2-(benzenesulfonyl)ethoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(OCCS(=O)(=O)c2ccccc2)ccc1O |
| InChI | InChI=1S/C15H14O6S/c16-14-7-6-11(10-13(14)15(17)18)21-8-9-22(19,20)12-4-2-1-3-5-12/h1-7,10,16H,8-9H2,(H,17,18) |
| InChIKey | NJPAQCODFFVRCJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |