C16H16O6S — CID 23374955
4-[3-(benzenesulfonyl)propoxy]-2-hydroxybenzoic acid (PubChem CID 23374955) has the molecular formula C16H16O6S and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[3-(benzenesulfonyl)propoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-(benzenesulfonyl)propoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 23374955 |
| Molecular Formula | C16H16O6S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 4-[3-(benzenesulfonyl)propoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(OCCCS(=O)(=O)c2ccccc2)cc1O |
| InChI | InChI=1S/C16H16O6S/c17-15-11-12(7-8-14(15)16(18)19)22-9-4-10-23(20,21)13-5-2-1-3-6-13/h1-3,5-8,11,17H,4,9-10H2,(H,18,19) |
| InChIKey | QUHGYIOKOJVXQS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|