C17H16O8 — CID 71341364
4-[3-(4-carboxy-3-hydroxyphenoxy)propoxy]-2-hydroxybenzoic acid (PubChem CID 71341364) has the molecular formula C17H16O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 4-[3-(4-carboxy-3-hydroxyphenoxy)propoxy]-2-hydroxybenzoic acid.
| Compound Name | 4-[3-(4-carboxy-3-hydroxyphenoxy)propoxy]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 71341364 |
| Molecular Formula | C17H16O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[3-(4-carboxy-3-hydroxyphenoxy)propoxy]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(OCCCOc2ccc(C(=O)O)c(O)c2)cc1O |
| InChI | InChI=1S/C17H16O8/c18-14-8-10(2-4-12(14)16(20)21)24-6-1-7-25-11-3-5-13(17(22)23)15(19)9-11/h2-5,8-9,18-19H,1,6-7H2,(H,20,21)(H,22,23) |
| InChIKey | SBSMPFSMMUYBJE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|