C16H16O6 — CID 67375658
2-hydroxy-4-[2-(4-hydroxy-2-methylphenoxy)ethoxy]benzoic acid (PubChem CID 67375658) has the molecular formula C16H16O6 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-hydroxy-4-[2-(4-hydroxy-2-methylphenoxy)ethoxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[2-(4-hydroxy-2-methylphenoxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 67375658 |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-hydroxy-4-[2-(4-hydroxy-2-methylphenoxy)ethoxy]benzoic acid |
| SMILES | Cc1cc(O)ccc1OCCOc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C16H16O6/c1-10-8-11(17)2-5-15(10)22-7-6-21-12-3-4-13(16(19)20)14(18)9-12/h2-5,8-9,17-18H,6-7H2,1H3,(H,19,20) |
| InChIKey | XPPPUQPLRPJNHJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|