2,4-dihydroxybenzoic acid

C7H6O4 — CID 1491

IUPAC2,4-dihydroxybenzoic acid
SMILESO=C(O)c1ccc(O)cc1O
InChIInChI=1S/C7H6O4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H,(H,10,11)
InChIKeyUIAFKZKHHVMJGS-UHFFFAOYSA-N
MW154.12 g/mol
LogP0.80
Rot. Bonds1

About 2,4-dihydroxybenzoic acid

2,4-dihydroxybenzoic acid (PubChem CID 1491) has the molecular formula C7H6O4 and a molecular weight of 154.12 g/mol. Its IUPAC name is 2,4-dihydroxybenzoic acid.

Molecular Properties

Compound Name2,4-dihydroxybenzoic acid
PubChem CID1491
Molecular FormulaC7H6O4
Molecular Weight154.12 g/mol
Exact Mass154.03
IUPAC Name2,4-dihydroxybenzoic acid
SMILESO=C(O)c1ccc(O)cc1O
InChIInChI=1S/C7H6O4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H,(H,10,11)
InChIKeyUIAFKZKHHVMJGS-UHFFFAOYSA-N
XLogP0.80
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.12
LogP ≤ 50.80
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,4-dihydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-hydroxybenzoic acid;2-hydroxyterephthalic acid
CID 174971569
3,5-dichloro-2,4-dihydroxybenzoic acid;2,4-dihydroxybenzoic acid
CID 161415346
4-hydroxyphthalic acid;hydrate
CID 171991193
2-(2,4-dihydroxybenzoyl)oxy-4-hydroxybenzoic acid
CID 54530363
2,5-dihydroxybenzoic acid;dihydrate
CID 140769659
1-(2,4-dihydroxyphenyl)-2-hydroxyethanone
CID 11715230
2,5-dihydroxybenzoic acid;methanol
CID 174970806
strontium;2,5-dihydroxybenzoic acid;hydride
CID 173389066
3,7-dihydroxynaphthalene-2-carboxylic acid
CID 158168218
4-(1-hydroxyethenyl)benzene-1,3-diol
CID 89199480
ethane;2-hydroxy-4-methylbenzoic acid
CID 145280120
CID 54715072
CID 54715072

Frequently Asked Questions

What is the IUPAC name of 2,4-dihydroxybenzoic acid?
The IUPAC name of 2,4-dihydroxybenzoic acid (CID 1491) is 2,4-dihydroxybenzoic acid.
What is the SMILES notation for 2,4-dihydroxybenzoic acid?
The canonical SMILES for 2,4-dihydroxybenzoic acid is O=C(O)c1ccc(O)cc1O.
What is the InChIKey of 2,4-dihydroxybenzoic acid?
The InChIKey is UIAFKZKHHVMJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,8-9H,(H,10,11).
What are the key properties of 2,4-dihydroxybenzoic acid?
2,4-dihydroxybenzoic acid has a molecular weight of 154.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydroxybenzoic acid is sourced from PubChem (CID 1491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).