C8H8O4 — CID 11715230
1-(2,4-dihydroxyphenyl)-2-hydroxyethanone (PubChem CID 11715230) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-2-hydroxyethanone.
| Compound Name | 1-(2,4-dihydroxyphenyl)-2-hydroxyethanone |
|---|---|
| PubChem CID | 11715230 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-2-hydroxyethanone |
| SMILES | O=C(CO)c1ccc(O)cc1O |
| InChI | InChI=1S/C8H8O4/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,9-11H,4H2 |
| InChIKey | DYKBONVDLJHZLM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |