C9H10O4 — CID 130033868
1-(2,4-dihydroxyphenyl)-3-hydroxypropan-1-one (PubChem CID 130033868) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-3-hydroxypropan-1-one.
| Compound Name | 1-(2,4-dihydroxyphenyl)-3-hydroxypropan-1-one |
|---|---|
| PubChem CID | 130033868 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-3-hydroxypropan-1-one |
| SMILES | O=C(CCO)c1ccc(O)cc1O |
| InChI | InChI=1S/C9H10O4/c10-4-3-8(12)7-2-1-6(11)5-9(7)13/h1-2,5,10-11,13H,3-4H2 |
| InChIKey | SUEJNVKQKDNTTP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |