C16H16O4 — CID 16641365
1-(2,4-dihydroxyphenyl)-2-(2,5-dimethylphenoxy)ethanone (PubChem CID 16641365) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(2,4-dihydroxyphenyl)-2-(2,5-dimethylphenoxy)ethanone.
| Compound Name | 1-(2,4-dihydroxyphenyl)-2-(2,5-dimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 16641365 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(2,4-dihydroxyphenyl)-2-(2,5-dimethylphenoxy)ethanone |
| SMILES | Cc1ccc(C)c(OCC(=O)c2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C16H16O4/c1-10-3-4-11(2)16(7-10)20-9-15(19)13-6-5-12(17)8-14(13)18/h3-8,17-18H,9H2,1-2H3 |
| InChIKey | LMFMQRALTRFWRK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |