C11H14O3 — CID 729953
methyl 2-(2,5-dimethylphenoxy)acetate (PubChem CID 729953) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is methyl 2-(2,5-dimethylphenoxy)acetate.
| Compound Name | methyl 2-(2,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 729953 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | methyl 2-(2,5-dimethylphenoxy)acetate |
| SMILES | COC(=O)COc1cc(C)ccc1C |
| InChI | InChI=1S/C11H14O3/c1-8-4-5-9(2)10(6-8)14-7-11(12)13-3/h4-6H,7H2,1-3H3 |
| InChIKey | MJHCVYQQBIXYGN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |