C28H40N2O4 — CID 17233348
2-(2,5-dimethylphenoxy)-N-[8-[[2-(2,5-dimethylphenoxy)acetyl]amino]octyl]acetamide (PubChem CID 17233348) has the molecular formula C28H40N2O4 and a molecular weight of 468.64 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[8-[[2-(2,5-dimethylphenoxy)acetyl]amino]octyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[8-[[2-(2,5-dimethylphenoxy)acetyl]amino]octyl]acetamide |
|---|---|
| PubChem CID | 17233348 |
| Molecular Formula | C28H40N2O4 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.30 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[8-[[2-(2,5-dimethylphenoxy)acetyl]amino]octyl]acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCCCCCCCNC(=O)COc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C28H40N2O4/c1-21-11-13-23(3)25(17-21)33-19-27(31)29-15-9-7-5-6-8-10-16-30-28(32)20-34-26-18-22(2)12-14-24(26)4/h11-14,17-18H,5-10,15-16,19-20H2,1-4H3,(H,29,31)(H,30,32) |
| InChIKey | KNDPBIHWSHZFHT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|