C15H25ClN2O2 — CID 163329160
N-[3-(dimethylamino)propyl]-2-(2,5-dimethylphenoxy)acetamide;hydrochloride (PubChem CID 163329160) has the molecular formula C15H25ClN2O2 and a molecular weight of 300.83 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(2,5-dimethylphenoxy)acetamide;hydrochloride.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(2,5-dimethylphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 163329160 |
| Molecular Formula | C15H25ClN2O2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(2,5-dimethylphenoxy)acetamide;hydrochloride |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCCN(C)C)c1.Cl |
| InChI | InChI=1S/C15H24N2O2.ClH/c1-12-6-7-13(2)14(10-12)19-11-15(18)16-8-5-9-17(3)4;/h6-7,10H,5,8-9,11H2,1-4H3,(H,16,18);1H |
| InChIKey | XXOYENCIMCBQEH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|