C15H11NO4 — CID 38900024
4-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzonitrile (PubChem CID 38900024) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzonitrile.
| Compound Name | 4-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 38900024 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 4-[2-(2,4-dihydroxyphenyl)-2-oxoethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(=O)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C15H11NO4/c16-8-10-1-4-12(5-2-10)20-9-15(19)13-6-3-11(17)7-14(13)18/h1-7,17-18H,9H2 |
| InChIKey | CXTYOJAEEUGUCU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |