C17H15NO4 — CID 7627302
4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]benzonitrile (PubChem CID 7627302) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]benzonitrile.
| Compound Name | 4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]benzonitrile |
|---|---|
| PubChem CID | 7627302 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4-[2-(2,5-dimethoxyphenyl)-2-oxoethoxy]benzonitrile |
| SMILES | COc1ccc(OC)c(C(=O)COc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C17H15NO4/c1-20-14-7-8-17(21-2)15(9-14)16(19)11-22-13-5-3-12(10-18)4-6-13/h3-9H,11H2,1-2H3 |
| InChIKey | BNPQIVNAFMIPLC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |